C25H23N3O3 — CID 102398590
2-[(2S,3S)-18-methyl-10-oxo-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraen-3-yl]isoindole-1,3-dione (PubChem CID 102398590) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-[(2S,3S)-18-methyl-10-oxo-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraen-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3S)-18-methyl-10-oxo-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraen-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102398590 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[(2S,3S)-18-methyl-10-oxo-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(11),12,14,16-tetraen-3-yl]isoindole-1,3-dione |
| SMILES | Cn1c2c(c3ccccc31)C(=O)CN1CCCC[C@H](N3C(=O)c4ccccc4C3=O)[C@@H]21 |
| InChI | InChI=1S/C25H23N3O3/c1-26-18-11-5-4-10-17(18)21-20(29)14-27-13-7-6-12-19(22(27)23(21)26)28-24(30)15-8-2-3-9-16(15)25(28)31/h2-5,8-11,19,22H,6-7,12-14H2,1H3/t19-,22-/m0/s1 |
| InChIKey | GWKUUJVMYFHBNJ-UGKGYDQZSA-N |
| XLogP | 3.57 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|