About [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate
[(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 102399236) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate |
| PubChem CID | 102399236 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#C[C@H](OC(=O)C(C)(C)C)C1=CCC(C)(C)C1 |
| InChI | InChI=1S/C15H22O2/c1-7-12(17-13(16)14(2,3)4)11-8-9-15(5,6)10-11/h1,8,12H,9-10H2,2-6H3/t12-/m0/s1 |
| InChIKey | FJGYGCCLGUUBOE-LBPRGKRZSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate?
The IUPAC name of [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate (CID 102399236) is [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate is C#C[C@H](OC(=O)C(C)(C)C)C1=CCC(C)(C)C1.
What is the InChIKey of [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate?
The InChIKey is FJGYGCCLGUUBOE-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H22O2/c1-7-12(17-13(16)14(2,3)4)11-8-9-15(5,6)10-11/h1,8,12H,9-10H2,2-6H3/t12-/m0/s1.
What are the key properties of [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate?
[(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate has a molecular weight of 234.34 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(4,4-dimethylcyclopenten-1-yl)prop-2-ynyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 102399236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).