C20H33NO3Si — CID 102399515
methyl 3-[(1R,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-cyano-1,2,3,3a,6,7-hexahydroinden-5-yl]propanoate (PubChem CID 102399515) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is methyl 3-[(1R,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-cyano-1,2,3,3a,6,7-hexahydroinden-5-yl]propanoate.
| Compound Name | methyl 3-[(1R,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-cyano-1,2,3,3a,6,7-hexahydroinden-5-yl]propanoate |
|---|---|
| PubChem CID | 102399515 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | methyl 3-[(1R,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-cyano-1,2,3,3a,6,7-hexahydroinden-5-yl]propanoate |
| SMILES | COC(=O)CCC1=C[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C#N)CC1 |
| InChI | InChI=1S/C20H33NO3Si/c1-19(2,3)25(5,6)24-17-9-8-16-13-15(7-10-18(22)23-4)11-12-20(16,17)14-21/h13,16-17H,7-12H2,1-6H3/t16-,17-,20-/m1/s1 |
| InChIKey | IZNOANQBERCMEQ-MBOZVWFJSA-N |
| XLogP | 4.97 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|