C12H18N2 — CID 102399585
(4S,9S,9aS)-9-ethenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-4-carbonitrile (PubChem CID 102399585) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (4S,9S,9aS)-9-ethenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-4-carbonitrile.
| Compound Name | (4S,9S,9aS)-9-ethenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-4-carbonitrile |
|---|---|
| PubChem CID | 102399585 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (4S,9S,9aS)-9-ethenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-4-carbonitrile |
| SMILES | C=C[C@@H]1CCCN2[C@H](C#N)CCC[C@@H]12 |
| InChI | InChI=1S/C12H18N2/c1-2-10-5-4-8-14-11(9-13)6-3-7-12(10)14/h2,10-12H,1,3-8H2/t10-,11+,12+/m1/s1 |
| InChIKey | AFMWBFGQNXQJKZ-WOPDTQHZSA-N |
| XLogP | 2.33 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|