C11H20O — CID 102399716
(4S,5R,7S)-4,7-dimethyl-6-oxaspiro[4.5]decane (PubChem CID 102399716) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (4S,5R,7S)-4,7-dimethyl-6-oxaspiro[4.5]decane.
| Compound Name | (4S,5R,7S)-4,7-dimethyl-6-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102399716 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (4S,5R,7S)-4,7-dimethyl-6-oxaspiro[4.5]decane |
| SMILES | C[C@H]1CCC[C@@]2(CCC[C@@H]2C)O1 |
| InChI | InChI=1S/C11H20O/c1-9-5-3-7-11(9)8-4-6-10(2)12-11/h9-10H,3-8H2,1-2H3/t9-,10-,11+/m0/s1 |
| InChIKey | DLUPAXQFIRTLIG-GARJFASQSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |