C23H40O5Si — CID 102400202
dimethyl (1R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate (PubChem CID 102400202) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is dimethyl (1R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102400202 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | dimethyl (1R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=CCC2C(C)(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H40O5Si/c1-21(2,3)29(9,10)28-17-13-14-22(4,5)16-12-11-15(19(24)26-7)18(20(25)27-8)23(16,17)6/h11,16-18H,12-14H2,1-10H3/t16?,17-,18-,23-/m1/s1 |
| InChIKey | DVEVEMMPMVBKLS-QTUTZJNZSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|