C13H15F3O6 — CID 102400323
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[4-(trifluoromethyl)phenoxy]oxane-3,4,5-triol (PubChem CID 102400323) has the molecular formula C13H15F3O6 and a molecular weight of 324.25 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[4-(trifluoromethyl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[4-(trifluoromethyl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102400323 |
| Molecular Formula | C13H15F3O6 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[4-(trifluoromethyl)phenoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2ccc(C(F)(F)F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15F3O6/c14-13(15,16)6-1-3-7(4-2-6)21-12-11(20)10(19)9(18)8(5-17)22-12/h1-4,8-12,17-20H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | WIVMGDOPIIGCLL-RMPHRYRLSA-N |
| XLogP | -0.12 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |