About (Z)-3-methylbut-3-ene-1,2,4-triol
(Z)-3-methylbut-3-ene-1,2,4-triol (PubChem CID 102400402) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is (Z)-3-methylbut-3-ene-1,2,4-triol.
Molecular Properties
| Compound Name | (Z)-3-methylbut-3-ene-1,2,4-triol |
| PubChem CID | 102400402 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (Z)-3-methylbut-3-ene-1,2,4-triol |
| SMILES | C/C(=C/O)C(O)CO |
| InChI | InChI=1S/C5H10O3/c1-4(2-6)5(8)3-7/h2,5-8H,3H2,1H3/b4-2- |
| InChIKey | FVYHKVMWBMOFGS-RQOWECAXSA-N |
| XLogP | -0.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methylbut-3-ene-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methylbut-3-ene-1,2,4-triol?
The IUPAC name of (Z)-3-methylbut-3-ene-1,2,4-triol (CID 102400402) is (Z)-3-methylbut-3-ene-1,2,4-triol.
What is the SMILES notation for (Z)-3-methylbut-3-ene-1,2,4-triol?
The canonical SMILES for (Z)-3-methylbut-3-ene-1,2,4-triol is C/C(=C/O)C(O)CO.
What is the InChIKey of (Z)-3-methylbut-3-ene-1,2,4-triol?
The InChIKey is FVYHKVMWBMOFGS-RQOWECAXSA-N. The full InChI is InChI=1S/C5H10O3/c1-4(2-6)5(8)3-7/h2,5-8H,3H2,1H3/b4-2-.
What are the key properties of (Z)-3-methylbut-3-ene-1,2,4-triol?
(Z)-3-methylbut-3-ene-1,2,4-triol has a molecular weight of 118.13 g/mol, XLogP of -0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methylbut-3-ene-1,2,4-triol is sourced from PubChem (CID 102400402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).