C18H22N2O2 — CID 102400551
(4R)-4-ethenyl-1-[(4-methoxyphenyl)methyl]-3-(3-methylbuta-1,2-dienyl)imidazolidin-2-one (PubChem CID 102400551) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (4R)-4-ethenyl-1-[(4-methoxyphenyl)methyl]-3-(3-methylbuta-1,2-dienyl)imidazolidin-2-one.
| Compound Name | (4R)-4-ethenyl-1-[(4-methoxyphenyl)methyl]-3-(3-methylbuta-1,2-dienyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 102400551 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (4R)-4-ethenyl-1-[(4-methoxyphenyl)methyl]-3-(3-methylbuta-1,2-dienyl)imidazolidin-2-one |
| SMILES | C=C[C@@H]1CN(Cc2ccc(OC)cc2)C(=O)N1C=C=C(C)C |
| InChI | InChI=1S/C18H22N2O2/c1-5-16-13-19(18(21)20(16)11-10-14(2)3)12-15-6-8-17(22-4)9-7-15/h5-9,11,16H,1,12-13H2,2-4H3/t16-/m1/s1 |
| InChIKey | KWUQQJCZOSDSLI-MRXNPFEDSA-N |
| XLogP | 3.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|