C28H29N3+2 — CID 102400568
3,6-bis[2-(1-methylpyridin-1-ium-4-yl)ethyl]-9H-carbazole (PubChem CID 102400568) has the molecular formula C28H29N3+2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3,6-bis[2-(1-methylpyridin-1-ium-4-yl)ethyl]-9H-carbazole.
| Compound Name | 3,6-bis[2-(1-methylpyridin-1-ium-4-yl)ethyl]-9H-carbazole |
|---|---|
| PubChem CID | 102400568 |
| Molecular Formula | C28H29N3+2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 3,6-bis[2-(1-methylpyridin-1-ium-4-yl)ethyl]-9H-carbazole |
| SMILES | C[n+]1ccc(CCc2ccc3[nH]c4ccc(CCc5cc[n+](C)cc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C28H29N3/c1-30-15-11-21(12-16-30)3-5-23-7-9-27-25(19-23)26-20-24(8-10-28(26)29-27)6-4-22-13-17-31(2)18-14-22/h7-20,29H,3-6H2,1-2H3/q+2 |
| InChIKey | HZFBUDRKBWVPPH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|