C62H66S4Si2 — CID 102400721
[7-[4,5-diphenyl-2-tri(propan-2-yl)silylthieno[3,2-e][1]benzothiol-7-yl]-4,5-diphenylthieno[3,2-e][1]benzothiol-2-yl]-tri(propan-2-yl)silane (PubChem CID 102400721) has the molecular formula C62H66S4Si2 and a molecular weight of 995.65 g/mol. Its IUPAC name is [7-[4,5-diphenyl-2-tri(propan-2-yl)silylthieno[3,2-e][1]benzothiol-7-yl]-4,5-diphenylthieno[3,2-e][1]benzothiol-2-yl]-tri(propan-2-yl)silane.
| Compound Name | [7-[4,5-diphenyl-2-tri(propan-2-yl)silylthieno[3,2-e][1]benzothiol-7-yl]-4,5-diphenylthieno[3,2-e][1]benzothiol-2-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102400721 |
| Molecular Formula | C62H66S4Si2 |
| Molecular Weight | 995.65 g/mol |
| Exact Mass | 994.36 |
| IUPAC Name | [7-[4,5-diphenyl-2-tri(propan-2-yl)silylthieno[3,2-e][1]benzothiol-7-yl]-4,5-diphenylthieno[3,2-e][1]benzothiol-2-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](c1cc2c(s1)c(-c1ccccc1)c(-c1ccccc1)c1sc(-c3cc4c(s3)c(-c3ccccc3)c(-c3ccccc3)c3sc([Si](C(C)C)(C(C)C)C(C)C)cc34)cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C62H66S4Si2/c1-37(2)67(38(3)4,39(5)6)53-35-49-47-33-51(63-59(47)55(43-25-17-13-18-26-43)57(61(49)65-53)45-29-21-15-22-30-45)52-34-48-50-36-54(68(40(7)8,41(9)10)42(11)12)66-62(50)58(46-31-23-16-24-32-46)56(60(48)64-52)44-27-19-14-20-28-44/h13-42H,1-12H3 |
| InChIKey | YPUSKCPSPDQPOM-UHFFFAOYSA-N |
| XLogP | 20.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.65 |
| LogP ≤ 5 | 20.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|