About 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene
1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene (PubChem CID 102400755) has the molecular formula C22H22O5S
and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene.
Molecular Properties
| Compound Name | 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene |
| PubChem CID | 102400755 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(c2ccccc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H22O5S/c1-25-19-15-21(27-3)20(26-2)14-18(19)22(16-10-6-4-7-11-16)28(23,24)17-12-8-5-9-13-17/h4-15,22H,1-3H3 |
| InChIKey | ZJWIEMYBSMEEHB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene?
The IUPAC name of 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene (CID 102400755) is 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene.
What is the SMILES notation for 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene?
The canonical SMILES for 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene is COc1cc(OC)c(C(c2ccccc2)S(=O)(=O)c2ccccc2)cc1OC.
What is the InChIKey of 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene?
The InChIKey is ZJWIEMYBSMEEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O5S/c1-25-19-15-21(27-3)20(26-2)14-18(19)22(16-10-6-4-7-11-16)28(23,24)17-12-8-5-9-13-17/h4-15,22H,1-3H3.
What are the key properties of 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene?
1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene has a molecular weight of 398.48 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[benzenesulfonyl(phenyl)methyl]-2,4,5-trimethoxybenzene is sourced from PubChem (CID 102400755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).