C19H36O2 — CID 102400912
(E,2R,4R,7S,8R)-8-cyclohexyl-8-methoxy-2,4,5,7-tetramethyloct-5-en-1-ol (PubChem CID 102400912) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is (E,2R,4R,7S,8R)-8-cyclohexyl-8-methoxy-2,4,5,7-tetramethyloct-5-en-1-ol.
| Compound Name | (E,2R,4R,7S,8R)-8-cyclohexyl-8-methoxy-2,4,5,7-tetramethyloct-5-en-1-ol |
|---|---|
| PubChem CID | 102400912 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (E,2R,4R,7S,8R)-8-cyclohexyl-8-methoxy-2,4,5,7-tetramethyloct-5-en-1-ol |
| SMILES | CO[C@H](C1CCCCC1)[C@@H](C)/C=C(\C)[C@H](C)C[C@@H](C)CO |
| InChI | InChI=1S/C19H36O2/c1-14(13-20)11-15(2)16(3)12-17(4)19(21-5)18-9-7-6-8-10-18/h12,14-15,17-20H,6-11,13H2,1-5H3/b16-12+/t14-,15-,17+,19+/m1/s1 |
| InChIKey | UQGSWPIWFCBBCF-IRAMQAIKSA-N |
| XLogP | 4.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|