C10H6Cl2N6 — CID 102400986
2,6-bis(4-chloropyrazol-1-yl)pyrazine (PubChem CID 102400986) has the molecular formula C10H6Cl2N6 and a molecular weight of 281.11 g/mol. Its IUPAC name is 2,6-bis(4-chloropyrazol-1-yl)pyrazine.
| Compound Name | 2,6-bis(4-chloropyrazol-1-yl)pyrazine |
|---|---|
| PubChem CID | 102400986 |
| Molecular Formula | C10H6Cl2N6 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2,6-bis(4-chloropyrazol-1-yl)pyrazine |
| SMILES | Clc1cnn(-c2cncc(-n3cc(Cl)cn3)n2)c1 |
| InChI | InChI=1S/C10H6Cl2N6/c11-7-1-14-17(5-7)9-3-13-4-10(16-9)18-6-8(12)2-15-18/h1-6H |
| InChIKey | DCDDZNQSVPCNFC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |