C13H12Br2O5 — CID 102401380
3,4-dibromo-2-(2,4,5-trimethoxyphenyl)-2H-furan-5-one (PubChem CID 102401380) has the molecular formula C13H12Br2O5 and a molecular weight of 408.04 g/mol. Its IUPAC name is 3,4-dibromo-2-(2,4,5-trimethoxyphenyl)-2H-furan-5-one.
| Compound Name | 3,4-dibromo-2-(2,4,5-trimethoxyphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 102401380 |
| Molecular Formula | C13H12Br2O5 |
| Molecular Weight | 408.04 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 3,4-dibromo-2-(2,4,5-trimethoxyphenyl)-2H-furan-5-one |
| SMILES | COc1cc(OC)c(C2OC(=O)C(Br)=C2Br)cc1OC |
| InChI | InChI=1S/C13H12Br2O5/c1-17-7-5-9(19-3)8(18-2)4-6(7)12-10(14)11(15)13(16)20-12/h4-5,12H,1-3H3 |
| InChIKey | VSZAYOCMBYHHEJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |