About [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate
[(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate (PubChem CID 102401488) has the molecular formula C18H34O3Si
and a molecular weight of 326.55 g/mol. Its IUPAC name is [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate.
Molecular Properties
| Compound Name | [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate |
| PubChem CID | 102401488 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate |
| SMILES | C=CCCC(=O)O[C@@H](CC=C)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-9-11-13-17(19)20-16(12-10-2)14-15(3)21-22(7,8)18(4,5)6/h9-10,15-16H,1-2,11-14H2,3-8H3/t15-,16-/m0/s1 |
| InChIKey | IILVLYVFDJNNII-HOTGVXAUSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate?
The IUPAC name of [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate (CID 102401488) is [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate.
What is the SMILES notation for [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate?
The canonical SMILES for [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate is C=CCCC(=O)O[C@@H](CC=C)C[C@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate?
The InChIKey is IILVLYVFDJNNII-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H34O3Si/c1-9-11-13-17(19)20-16(12-10-2)14-15(3)21-22(7,8)18(4,5)6/h9-10,15-16H,1-2,11-14H2,3-8H3/t15-,16-/m0/s1.
What are the key properties of [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate?
[(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate has a molecular weight of 326.55 g/mol, XLogP of 5.24, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl] pent-4-enoate is sourced from PubChem (CID 102401488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).