C31H52O10Si — CID 102401623
(3R)-4-[(2S,4S,6S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-methoxy-5,5-dimethyloxan-2-yl]-3-triethylsilyloxybutanoic acid (PubChem CID 102401623) has the molecular formula C31H52O10Si and a molecular weight of 612.83 g/mol. Its IUPAC name is (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-methoxy-5,5-dimethyloxan-2-yl]-3-triethylsilyloxybutanoic acid.
| Compound Name | (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-methoxy-5,5-dimethyloxan-2-yl]-3-triethylsilyloxybutanoic acid |
|---|---|
| PubChem CID | 102401623 |
| Molecular Formula | C31H52O10Si |
| Molecular Weight | 612.83 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | (3R)-4-[(2S,4S,6S)-4-acetyloxy-6-[[(2S,4Z,6R)-6-ethenyl-4-(2-methoxy-2-oxoethylidene)oxan-2-yl]methyl]-6-methoxy-5,5-dimethyloxan-2-yl]-3-triethylsilyloxybutanoic acid |
| SMILES | C=C[C@H]1C/C(=C\C(=O)OC)C[C@@H](C[C@]2(OC)O[C@H](C[C@H](CC(=O)O)O[Si](CC)(CC)CC)C[C@H](OC(C)=O)C2(C)C)O1 |
| InChI | InChI=1S/C31H52O10Si/c1-10-23-14-22(16-29(35)36-8)15-26(39-23)20-31(37-9)30(6,7)27(38-21(5)32)18-24(40-31)17-25(19-28(33)34)41-42(11-2,12-3)13-4/h10,16,23-27H,1,11-15,17-20H2,2-9H3,(H,33,34)/b22-16+/t23-,24+,25+,26-,27-,31-/m0/s1 |
| InChIKey | SILDCNRFMSUTBY-PZSLCSNDSA-N |
| XLogP | 5.55 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|