About (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one
(6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one (PubChem CID 102401926) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one.
Molecular Properties
| Compound Name | (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one |
| PubChem CID | 102401926 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC=C(C)C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C18H34O2Si/c1-8-21(9-2,10-3)20-18(14-12-16(6)7)17(19)13-11-15(4)5/h11-12,18H,8-10,13-14H2,1-7H3/t18-/m0/s1 |
| InChIKey | VSQJLCSVHNOYOM-SFHVURJKSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one?
The IUPAC name of (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one (CID 102401926) is (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one.
What is the SMILES notation for (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one?
The canonical SMILES for (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one is CC[Si](CC)(CC)O[C@@H](CC=C(C)C)C(=O)CC=C(C)C.
What is the InChIKey of (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one?
The InChIKey is VSQJLCSVHNOYOM-SFHVURJKSA-N. The full InChI is InChI=1S/C18H34O2Si/c1-8-21(9-2,10-3)20-18(14-12-16(6)7)17(19)13-11-15(4)5/h11-12,18H,8-10,13-14H2,1-7H3/t18-/m0/s1.
What are the key properties of (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one?
(6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one has a molecular weight of 310.55 g/mol, XLogP of 5.66, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,9-dimethyl-6-triethylsilyloxydeca-2,8-dien-5-one is sourced from PubChem (CID 102401926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).