About N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide
N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide (PubChem CID 102402034) has the molecular formula C20H27NO4S
and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide |
| PubChem CID | 102402034 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC=C=C2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-17-6-8-19(9-7-17)26(22,23)21-14-4-2-3-5-18-10-12-20(13-11-18)24-15-16-25-20/h3,6-9,21H,2,4,10-16H2,1H3 |
| InChIKey | FVPOWBOIOVFAMH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide (CID 102402034) is N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NCCCC=C=C2CCC3(CC2)OCCO3)cc1.
What is the InChIKey of N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide?
The InChIKey is FVPOWBOIOVFAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO4S/c1-17-6-8-19(9-7-17)26(22,23)21-14-4-2-3-5-18-10-12-20(13-11-18)24-15-16-25-20/h3,6-9,21H,2,4,10-16H2,1H3.
What are the key properties of N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide?
N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide has a molecular weight of 377.51 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(1,4-dioxaspiro[4.5]decan-8-ylidene)pent-4-enyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 102402034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).