C16H30O3Si — CID 102402049
[(3R,4R,5R)-5-ethenyl-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-4-yl]oxy-triethylsilane (PubChem CID 102402049) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is [(3R,4R,5R)-5-ethenyl-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-4-yl]oxy-triethylsilane.
| Compound Name | [(3R,4R,5R)-5-ethenyl-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 102402049 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(3R,4R,5R)-5-ethenyl-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-4-yl]oxy-triethylsilane |
| SMILES | C=C[C@H]1OC(C)(C)C[C@@]2(CO2)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H30O3Si/c1-7-13-14(19-20(8-2,9-3)10-4)16(12-17-16)11-15(5,6)18-13/h7,13-14H,1,8-12H2,2-6H3/t13-,14-,16-/m1/s1 |
| InChIKey | XXQJXQMEUMKTAX-IIAWOOMASA-N |
| XLogP | 3.90 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|