C39H44N2O6 — CID 102402055
(6aS)-8-[4-[[(1S)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline (PubChem CID 102402055) has the molecular formula C39H44N2O6 and a molecular weight of 636.79 g/mol. Its IUPAC name is (6aS)-8-[4-[[(1S)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline.
| Compound Name | (6aS)-8-[4-[[(1S)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
|---|---|
| PubChem CID | 102402055 |
| Molecular Formula | C39H44N2O6 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | (6aS)-8-[4-[[(1S)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| SMILES | COc1cc(Oc2ccc(C[C@H]3c4cc(OC)c(OC)cc4CCN3C)cc2)c2c(c1)-c1c(OC)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C39H44N2O6/c1-40-14-12-24-17-34(43-4)35(44-5)22-28(24)31(40)16-23-8-10-26(11-9-23)47-33-20-27(42-3)19-30-29(33)21-32-37-25(13-15-41(32)2)18-36(45-6)39(46-7)38(30)37/h8-11,17-20,22,31-32H,12-16,21H2,1-7H3/t31-,32-/m0/s1 |
| InChIKey | IPKWLEQTARCXTL-ACHIHNKUSA-N |
| XLogP | 7.05 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |