C51H108N6O10P+3 — CID 102402132
[3-[bis[3-[dimethyl-[3-(nonanoylamino)propyl]azaniumyl]-2-hydroxypropoxy]-oxidophosphaniumyl]oxy-2-hydroxypropyl]-dimethyl-[3-(nonanoylamino)propyl]azanium (PubChem CID 102402132) has the molecular formula C51H108N6O10P+3 and a molecular weight of 996.43 g/mol. Its IUPAC name is [3-[bis[3-[dimethyl-[3-(nonanoylamino)propyl]azaniumyl]-2-hydroxypropoxy]-oxidophosphaniumyl]oxy-2-hydroxypropyl]-dimethyl-[3-(nonanoylamino)propyl]azanium.
| Compound Name | [3-[bis[3-[dimethyl-[3-(nonanoylamino)propyl]azaniumyl]-2-hydroxypropoxy]-oxidophosphaniumyl]oxy-2-hydroxypropyl]-dimethyl-[3-(nonanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 102402132 |
| Molecular Formula | C51H108N6O10P+3 |
| Molecular Weight | 996.43 g/mol |
| Exact Mass | 995.78 |
| IUPAC Name | [3-[bis[3-[dimethyl-[3-(nonanoylamino)propyl]azaniumyl]-2-hydroxypropoxy]-oxidophosphaniumyl]oxy-2-hydroxypropyl]-dimethyl-[3-(nonanoylamino)propyl]azanium |
| SMILES | CCCCCCCCC(=O)NCCC[N+](C)(C)CC(O)CO[P+]([O-])(OCC(O)C[N+](C)(C)CCCNC(=O)CCCCCCCC)OCC(O)C[N+](C)(C)CCCNC(=O)CCCCCCCC |
| InChI | InChI=1S/C51H105N6O10P/c1-10-13-16-19-22-25-31-49(61)52-34-28-37-55(4,5)40-46(58)43-65-68(64,66-44-47(59)41-56(6,7)38-29-35-53-50(62)32-26-23-20-17-14-11-2)67-45-48(60)42-57(8,9)39-30-36-54-51(63)33-27-24-21-18-15-12-3/h46-48,58-60H,10-45H2,1-9H3/p+3 |
| InChIKey | KUGMDGYOAUYIGB-UHFFFAOYSA-Q |
| XLogP | 6.16 |
| TPSA | 198.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|