About 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene
4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene (PubChem CID 102402600) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene.
Molecular Properties
| Compound Name | 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene |
| PubChem CID | 102402600 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene |
| SMILES | COC1=CC2N=C2C=C1 |
| InChI | InChI=1S/C7H7NO/c1-9-5-2-3-6-7(4-5)8-6/h2-4,7H,1H3 |
| InChIKey | HCADCXLNEQTGTN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene?
The IUPAC name of 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene (CID 102402600) is 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene.
What is the SMILES notation for 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene?
The canonical SMILES for 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene is COC1=CC2N=C2C=C1.
What is the InChIKey of 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene?
The InChIKey is HCADCXLNEQTGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-9-5-2-3-6-7(4-5)8-6/h2-4,7H,1H3.
What are the key properties of 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene?
4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene has a molecular weight of 121.14 g/mol, XLogP of 0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-7-azabicyclo[4.1.0]hepta-1(7),2,4-triene is sourced from PubChem (CID 102402600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).