C15H26O4 — CID 102403243
(1S,2R,4aR,7R)-7-hydroperoxy-4a-methyl-8-methylidene-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2-diol (PubChem CID 102403243) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,2R,4aR,7R)-7-hydroperoxy-4a-methyl-8-methylidene-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2-diol.
| Compound Name | (1S,2R,4aR,7R)-7-hydroperoxy-4a-methyl-8-methylidene-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2-diol |
|---|---|
| PubChem CID | 102403243 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1S,2R,4aR,7R)-7-hydroperoxy-4a-methyl-8-methylidene-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2-diol |
| SMILES | C=C1C2[C@H](O)[C@](O)(C(C)C)CC[C@@]2(C)CC[C@H]1OO |
| InChI | InChI=1S/C15H26O4/c1-9(2)15(17)8-7-14(4)6-5-11(19-18)10(3)12(14)13(15)16/h9,11-13,16-18H,3,5-8H2,1-2,4H3/t11-,12?,13+,14-,15-/m1/s1 |
| InChIKey | DNJJWMLNDCTUME-ZQQMXMEDSA-N |
| XLogP | 2.36 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|