C13H13F6NO3 — CID 102403422
4-[4-(dimethylamino)-2-hydroxyphenyl]-1,1,1,5,5,5-hexafluoro-4-hydroxypentan-2-one (PubChem CID 102403422) has the molecular formula C13H13F6NO3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-2-hydroxyphenyl]-1,1,1,5,5,5-hexafluoro-4-hydroxypentan-2-one.
| Compound Name | 4-[4-(dimethylamino)-2-hydroxyphenyl]-1,1,1,5,5,5-hexafluoro-4-hydroxypentan-2-one |
|---|---|
| PubChem CID | 102403422 |
| Molecular Formula | C13H13F6NO3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[4-(dimethylamino)-2-hydroxyphenyl]-1,1,1,5,5,5-hexafluoro-4-hydroxypentan-2-one |
| SMILES | CN(C)c1ccc(C(O)(CC(=O)C(F)(F)F)C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C13H13F6NO3/c1-20(2)7-3-4-8(9(21)5-7)11(23,13(17,18)19)6-10(22)12(14,15)16/h3-5,21,23H,6H2,1-2H3 |
| InChIKey | OACCOPRHHXOCRW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|