C10H23BO3Si — CID 102404148
ethoxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane (PubChem CID 102404148) has the molecular formula C10H23BO3Si and a molecular weight of 230.19 g/mol. Its IUPAC name is ethoxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane.
| Compound Name | ethoxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
|---|---|
| PubChem CID | 102404148 |
| Molecular Formula | C10H23BO3Si |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | ethoxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
| SMILES | CCO[Si](C)(C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H23BO3Si/c1-8-12-15(6,7)11-13-9(2,3)10(4,5)14-11/h8H2,1-7H3 |
| InChIKey | LNWQPJIUHZQMNR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|