About [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene
[2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene (PubChem CID 102404809) has the molecular formula C15H17F3O2
and a molecular weight of 286.29 g/mol. Its IUPAC name is [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene.
Molecular Properties
| Compound Name | [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene |
| PubChem CID | 102404809 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene |
| SMILES | C=CC(OCC)C(OC(=C)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H17F3O2/c1-4-13(19-5-2)14(12-9-7-6-8-10-12)20-11(3)15(16,17)18/h4,6-10,13-14H,1,3,5H2,2H3 |
| InChIKey | RWKSWBOEBOLLEK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene?
The IUPAC name of [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene (CID 102404809) is [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene.
What is the SMILES notation for [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene?
The canonical SMILES for [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene is C=CC(OCC)C(OC(=C)C(F)(F)F)c1ccccc1.
What is the InChIKey of [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene?
The InChIKey is RWKSWBOEBOLLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3O2/c1-4-13(19-5-2)14(12-9-7-6-8-10-12)20-11(3)15(16,17)18/h4,6-10,13-14H,1,3,5H2,2H3.
What are the key properties of [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene?
[2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene has a molecular weight of 286.29 g/mol, XLogP of 4.41, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethoxy-1-(3,3,3-trifluoroprop-1-en-2-yloxy)but-3-enyl]benzene is sourced from PubChem (CID 102404809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).