C16H15NO — CID 102404836
3-[(2-methoxyphenyl)methyl]-1H-indole (PubChem CID 102404836) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl]-1H-indole.
| Compound Name | 3-[(2-methoxyphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 102404836 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl]-1H-indole |
| SMILES | COc1ccccc1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H15NO/c1-18-16-9-5-2-6-12(16)10-13-11-17-15-8-4-3-7-14(13)15/h2-9,11,17H,10H2,1H3 |
| InChIKey | BQZKTQOKIZYNJG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |