C12H16O5 — CID 102404948
(1R,2R,4R,5S,7R)-9,9-dimethylspiro[3,8,10-trioxatricyclo[5.3.0.02,4]decane-5,5'-oxolane]-2'-one (PubChem CID 102404948) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (1R,2R,4R,5S,7R)-9,9-dimethylspiro[3,8,10-trioxatricyclo[5.3.0.02,4]decane-5,5'-oxolane]-2'-one.
| Compound Name | (1R,2R,4R,5S,7R)-9,9-dimethylspiro[3,8,10-trioxatricyclo[5.3.0.02,4]decane-5,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 102404948 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1R,2R,4R,5S,7R)-9,9-dimethylspiro[3,8,10-trioxatricyclo[5.3.0.02,4]decane-5,5'-oxolane]-2'-one |
| SMILES | CC1(C)O[C@H]2[C@H]3O[C@H]3[C@]3(CCC(=O)O3)C[C@H]2O1 |
| InChI | InChI=1S/C12H16O5/c1-11(2)15-6-5-12(4-3-7(13)16-12)10-9(14-10)8(6)17-11/h6,8-10H,3-5H2,1-2H3/t6-,8-,9-,10-,12+/m1/s1 |
| InChIKey | RZJWQZZIDVDJMK-ZYJZCQHASA-N |
| XLogP | 0.75 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|