About 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine
4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine (PubChem CID 102405444) has the molecular formula C19H24N2S
and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine.
Molecular Properties
| Compound Name | 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine |
| PubChem CID | 102405444 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine |
| SMILES | CC(C)/N=c1\ccc(Sc2ccccc2)ccc1NC(C)C |
| InChI | InChI=1S/C19H24N2S/c1-14(2)20-18-12-10-17(11-13-19(18)21-15(3)4)22-16-8-6-5-7-9-16/h5-15H,1-4H3,(H,20,21) |
| InChIKey | IFNSGLOXIUPFNA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine?
The IUPAC name of 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine (CID 102405444) is 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine.
What is the SMILES notation for 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine?
The canonical SMILES for 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine is CC(C)/N=c1\ccc(Sc2ccccc2)ccc1NC(C)C.
What is the InChIKey of 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine?
The InChIKey is IFNSGLOXIUPFNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2S/c1-14(2)20-18-12-10-17(11-13-19(18)21-15(3)4)22-16-8-6-5-7-9-16/h5-15H,1-4H3,(H,20,21).
What are the key properties of 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine?
4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine has a molecular weight of 312.48 g/mol, XLogP of 4.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylsulfanyl-N-propan-2-yl-7-propan-2-yliminocyclohepta-1,3,5-trien-1-amine is sourced from PubChem (CID 102405444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).