C16H16S2 — CID 102405582
tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dithiol (PubChem CID 102405582) has the molecular formula C16H16S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dithiol.
| Compound Name | tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dithiol |
|---|---|
| PubChem CID | 102405582 |
| Molecular Formula | C16H16S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dithiol |
| SMILES | Sc1cc2ccc1CCc1ccc(cc1S)CC2 |
| InChI | InChI=1S/C16H16S2/c17-15-9-11-1-2-12-4-6-14(16(18)10-12)8-7-13(15)5-3-11/h3-6,9-10,17-18H,1-2,7-8H2 |
| InChIKey | YXTHMULDLZOTKP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|