C34H37N5 — CID 102405841
(1R,9R)-N-[3-[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]imino]-5,6-dimethylisoindol-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-amine (PubChem CID 102405841) has the molecular formula C34H37N5 and a molecular weight of 515.71 g/mol. Its IUPAC name is (1R,9R)-N-[3-[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]imino]-5,6-dimethylisoindol-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-amine.
| Compound Name | (1R,9R)-N-[3-[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]imino]-5,6-dimethylisoindol-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 102405841 |
| Molecular Formula | C34H37N5 |
| Molecular Weight | 515.71 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | (1R,9R)-N-[3-[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]imino]-5,6-dimethylisoindol-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-amine |
| SMILES | Cc1cc2c(cc1C)/C(=N/c1cc3c(cn1)[C@@H]1C[C@H](C3)C1(C)C)N=C2Nc1cc2c(cn1)[C@@H]1C[C@H](C2)C1(C)C |
| InChI | InChI=1S/C34H37N5/c1-17-7-23-24(8-18(17)2)32(38-30-12-20-10-22-14-28(34(22,5)6)26(20)16-36-30)39-31(23)37-29-11-19-9-21-13-27(33(21,3)4)25(19)15-35-29/h7-8,11-12,15-16,21-22,27-28H,9-10,13-14H2,1-6H3,(H,35,36,37,38,39)/t21-,22-,27-,28-/m0/s1 |
| InChIKey | CHEGAFOHKMBEQX-MPPVQRIUSA-N |
| XLogP | 7.42 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.71 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|