C12H17IO6 — CID 102406006
(1R,5R,7R,8R)-1-hydroxy-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one (PubChem CID 102406006) has the molecular formula C12H17IO6 and a molecular weight of 384.17 g/mol. Its IUPAC name is (1R,5R,7R,8R)-1-hydroxy-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one.
| Compound Name | (1R,5R,7R,8R)-1-hydroxy-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 102406006 |
| Molecular Formula | C12H17IO6 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (1R,5R,7R,8R)-1-hydroxy-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one |
| SMILES | CO[C@]1(C)OC[C@]2(O[C@@]1(C)OC)C(=O)C(I)=C[C@H]2O |
| InChI | InChI=1S/C12H17IO6/c1-10(16-3)11(2,17-4)19-12(6-18-10)8(14)5-7(13)9(12)15/h5,8,14H,6H2,1-4H3/t8-,10-,11-,12-/m1/s1 |
| InChIKey | QBAPHIUKVNGWKQ-HJQYOEGKSA-N |
| XLogP | 0.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|