C20H16INO3 — CID 102406367
(3S,5'E)-5'-(iodomethylidene)-2-[(1S)-1-phenylethyl]spiro[isoindole-3,3'-oxolane]-1,2'-dione (PubChem CID 102406367) has the molecular formula C20H16INO3 and a molecular weight of 445.26 g/mol. Its IUPAC name is (3S,5'E)-5'-(iodomethylidene)-2-[(1S)-1-phenylethyl]spiro[isoindole-3,3'-oxolane]-1,2'-dione.
| Compound Name | (3S,5'E)-5'-(iodomethylidene)-2-[(1S)-1-phenylethyl]spiro[isoindole-3,3'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 102406367 |
| Molecular Formula | C20H16INO3 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | (3S,5'E)-5'-(iodomethylidene)-2-[(1S)-1-phenylethyl]spiro[isoindole-3,3'-oxolane]-1,2'-dione |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)c2ccccc2[C@]12C/C(=C\I)OC2=O |
| InChI | InChI=1S/C20H16INO3/c1-13(14-7-3-2-4-8-14)22-18(23)16-9-5-6-10-17(16)20(22)11-15(12-21)25-19(20)24/h2-10,12-13H,11H2,1H3/b15-12+/t13-,20-/m0/s1 |
| InChIKey | NXJKQQKPKXIOQS-YFABTCRUSA-N |
| XLogP | 4.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|