About (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde
(1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde (PubChem CID 102406675) has the molecular formula C15H15BrO2
and a molecular weight of 307.19 g/mol. Its IUPAC name is (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde |
| PubChem CID | 102406675 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde |
| SMILES | CC1=C(C=O)[C@@H](c2ccc(Br)cc2)[C@H](C=O)CC1 |
| InChI | InChI=1S/C15H15BrO2/c1-10-2-3-12(8-17)15(14(10)9-18)11-4-6-13(16)7-5-11/h4-9,12,15H,2-3H2,1H3/t12-,15-/m0/s1 |
| InChIKey | NPBLROQCRKKJSN-WFASDCNBSA-N |
| XLogP | 3.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde?
The IUPAC name of (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde (CID 102406675) is (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde.
What is the SMILES notation for (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde?
The canonical SMILES for (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde is CC1=C(C=O)[C@@H](c2ccc(Br)cc2)[C@H](C=O)CC1.
What is the InChIKey of (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde?
The InChIKey is NPBLROQCRKKJSN-WFASDCNBSA-N. The full InChI is InChI=1S/C15H15BrO2/c1-10-2-3-12(8-17)15(14(10)9-18)11-4-6-13(16)7-5-11/h4-9,12,15H,2-3H2,1H3/t12-,15-/m0/s1.
What are the key properties of (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde?
(1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde has a molecular weight of 307.19 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-(4-bromophenyl)-4-methylcyclohex-3-ene-1,3-dicarbaldehyde is sourced from PubChem (CID 102406675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).