C19H22F16O5S — CID 102406697
S-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]decyl] ethanethioate (PubChem CID 102406697) has the molecular formula C19H22F16O5S and a molecular weight of 666.41 g/mol. Its IUPAC name is S-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]decyl] ethanethioate.
| Compound Name | S-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]decyl] ethanethioate |
|---|---|
| PubChem CID | 102406697 |
| Molecular Formula | C19H22F16O5S |
| Molecular Weight | 666.41 g/mol |
| Exact Mass | 666.09 |
| IUPAC Name | S-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]decyl] ethanethioate |
| SMILES | COCCOCCOCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CSC(C)=O |
| InChI | InChI=1S/C19H22F16O5S/c1-11(36)41-10-13(22,23)15(26,27)17(30,31)19(34,35)18(32,33)16(28,29)14(24,25)12(20,21)9-40-8-7-39-6-5-38-4-3-37-2/h3-10H2,1-2H3 |
| InChIKey | CTPGXZLOALVWJL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|