About (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one
(2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one (PubChem CID 10240835) has the molecular formula C5H8O4
and a molecular weight of 132.11 g/mol. Its IUPAC name is (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one.
Molecular Properties
| Compound Name | (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one |
| PubChem CID | 10240835 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one |
| SMILES | C[C@]1(O)OC[C@H](O)C1=O |
| InChI | InChI=1S/C5H8O4/c1-5(8)4(7)3(6)2-9-5/h3,6,8H,2H2,1H3/t3-,5-/m0/s1 |
| InChIKey | CCVJVKWZZMMBHB-UCORVYFPSA-N |
| XLogP | -1.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one?
The IUPAC name of (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one (CID 10240835) is (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one.
What is the SMILES notation for (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one?
The canonical SMILES for (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one is C[C@]1(O)OC[C@H](O)C1=O.
What is the InChIKey of (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one?
The InChIKey is CCVJVKWZZMMBHB-UCORVYFPSA-N. The full InChI is InChI=1S/C5H8O4/c1-5(8)4(7)3(6)2-9-5/h3,6,8H,2H2,1H3/t3-,5-/m0/s1.
What are the key properties of (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one?
(2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one has a molecular weight of 132.11 g/mol, XLogP of -1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2,4-dihydroxy-2-methyloxolan-3-one is sourced from PubChem (CID 10240835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).