C20H34O2 — CID 102408592
(1R,3E,6S,7E,11R,12R)-4,8,12,15,15-pentamethylbicyclo[9.3.1]pentadeca-3,7-diene-6,12-diol (PubChem CID 102408592) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1R,3E,6S,7E,11R,12R)-4,8,12,15,15-pentamethylbicyclo[9.3.1]pentadeca-3,7-diene-6,12-diol.
| Compound Name | (1R,3E,6S,7E,11R,12R)-4,8,12,15,15-pentamethylbicyclo[9.3.1]pentadeca-3,7-diene-6,12-diol |
|---|---|
| PubChem CID | 102408592 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1R,3E,6S,7E,11R,12R)-4,8,12,15,15-pentamethylbicyclo[9.3.1]pentadeca-3,7-diene-6,12-diol |
| SMILES | C/C1=C\[C@@H](O)C/C(C)=C/C[C@H]2CC[C@@](C)(O)[C@H](CC1)C2(C)C |
| InChI | InChI=1S/C20H34O2/c1-14-6-8-16-10-11-20(5,22)18(19(16,3)4)9-7-15(2)13-17(21)12-14/h6,13,16-18,21-22H,7-12H2,1-5H3/b14-6+,15-13+/t16-,17-,18+,20+/m0/s1 |
| InChIKey | ZFZJGHUIXOHECQ-CBAGNANHSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|