About 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile
5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile (PubChem CID 102408738) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile |
| PubChem CID | 102408738 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile |
| SMILES | CC1(O)CCCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C12H13NO/c1-12(14)6-2-3-10-7-9(8-13)4-5-11(10)12/h4-5,7,14H,2-3,6H2,1H3 |
| InChIKey | XUBFOHAFWIXBQH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile?
The IUPAC name of 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile (CID 102408738) is 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile.
What is the SMILES notation for 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile?
The canonical SMILES for 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile is CC1(O)CCCc2cc(C#N)ccc21.
What is the InChIKey of 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile?
The InChIKey is XUBFOHAFWIXBQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-12(14)6-2-3-10-7-9(8-13)4-5-11(10)12/h4-5,7,14H,2-3,6H2,1H3.
What are the key properties of 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile?
5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile has a molecular weight of 187.24 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-5-methyl-7,8-dihydro-6H-naphthalene-2-carbonitrile is sourced from PubChem (CID 102408738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).