C15H20O4 — CID 102409090
[(1E,4Z,7E)-8-(acetyloxymethyl)-5-methylcycloocta-1,4,7-trien-1-yl]methyl acetate (PubChem CID 102409090) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is [(1E,4Z,7E)-8-(acetyloxymethyl)-5-methylcycloocta-1,4,7-trien-1-yl]methyl acetate.
| Compound Name | [(1E,4Z,7E)-8-(acetyloxymethyl)-5-methylcycloocta-1,4,7-trien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 102409090 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | [(1E,4Z,7E)-8-(acetyloxymethyl)-5-methylcycloocta-1,4,7-trien-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C/C/C=C(/C)C/C=C\1COC(C)=O |
| InChI | InChI=1S/C15H20O4/c1-11-5-4-6-14(9-18-12(2)16)15(8-7-11)10-19-13(3)17/h5-6,8H,4,7,9-10H2,1-3H3/b11-5-,14-6-,15-8- |
| InChIKey | JPHDWGMDIOVTJW-FLDGLWQHSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|