About (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one
(1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 102409189) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one.
Molecular Properties
| Compound Name | (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one |
| PubChem CID | 102409189 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1C[C@@H]2C[C@@H](CCO2)O1 |
| InChI | InChI=1S/C7H10O3/c8-7-4-6-3-5(10-7)1-2-9-6/h5-6H,1-4H2/t5-,6+/m1/s1 |
| InChIKey | SWMLUNRIVMOIAF-RITPCOANSA-N |
| XLogP | 0.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one?
The IUPAC name of (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one (CID 102409189) is (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one is O=C1C[C@@H]2C[C@@H](CCO2)O1.
What is the InChIKey of (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one?
The InChIKey is SWMLUNRIVMOIAF-RITPCOANSA-N. The full InChI is InChI=1S/C7H10O3/c8-7-4-6-3-5(10-7)1-2-9-6/h5-6H,1-4H2/t5-,6+/m1/s1.
What are the key properties of (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one?
(1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one has a molecular weight of 142.15 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-2,6-dioxabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 102409189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).