About CID 102409239
CID 102409239 (PubChem CID 102409239) has the molecular formula C27H12Cl8N
and a molecular weight of 634.02 g/mol.
Molecular Properties
| Compound Name | CID 102409239 |
| PubChem CID | 102409239 |
| Molecular Formula | C27H12Cl8N |
| Molecular Weight | 634.02 g/mol |
| Exact Mass | 629.85 |
| IUPAC Name | — |
| SMILES | Clc1cc(Cl)c([C](c2c(Cl)cc(Cl)cc2Cl)c2c(Cl)cc(-n3ccc4ccccc43)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H12Cl8N/c28-14-7-17(30)24(18(31)8-14)27(25-19(32)9-15(29)10-20(25)33)26-21(34)11-16(12-22(26)35)36-6-5-13-3-1-2-4-23(13)36/h1-12H |
| InChIKey | UWROFVPBWWGFSZ-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.02 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 102409239 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102409239?
The IUPAC name of CID 102409239 (CID 102409239) is not available.
What is the SMILES notation for CID 102409239?
The canonical SMILES for CID 102409239 is Clc1cc(Cl)c([C](c2c(Cl)cc(Cl)cc2Cl)c2c(Cl)cc(-n3ccc4ccccc43)cc2Cl)c(Cl)c1.
What is the InChIKey of CID 102409239?
The InChIKey is UWROFVPBWWGFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H12Cl8N/c28-14-7-17(30)24(18(31)8-14)27(25-19(32)9-15(29)10-20(25)33)26-21(34)11-16(12-22(26)35)36-6-5-13-3-1-2-4-23(13)36/h1-12H.
What are the key properties of CID 102409239?
CID 102409239 has a molecular weight of 634.02 g/mol, XLogP of 11.88, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102409239 is sourced from PubChem (CID 102409239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).