C17H30O7 — CID 102409361
(1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid (PubChem CID 102409361) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102409361 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid |
| SMILES | CCOC(=O)[C@@H]1C[C@H](C(=O)O)[C@H](OC)[C@H](OC(CC)CC)[C@@H]1OC |
| InChI | InChI=1S/C17H30O7/c1-6-10(7-2)24-15-13(21-4)11(16(18)19)9-12(14(15)22-5)17(20)23-8-3/h10-15H,6-9H2,1-5H3,(H,18,19)/t11-,12+,13-,14+,15-/m0/s1 |
| InChIKey | MXVUPGOMUDDRJL-ZQNQSHIBSA-N |
| XLogP | 1.87 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |