About N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine
N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine (PubChem CID 102409585) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine |
| PubChem CID | 102409585 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine |
| SMILES | CNCCNC(C)=CC1=NCCN1C |
| InChI | InChI=1S/C10H20N4/c1-9(12-5-4-11-2)8-10-13-6-7-14(10)3/h8,11-12H,4-7H2,1-3H3 |
| InChIKey | WEYAOEHQHPIWDL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine?
The IUPAC name of N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine (CID 102409585) is N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine?
The canonical SMILES for N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine is CNCCNC(C)=CC1=NCCN1C.
What is the InChIKey of N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine?
The InChIKey is WEYAOEHQHPIWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-9(12-5-4-11-2)8-10-13-6-7-14(10)3/h8,11-12H,4-7H2,1-3H3.
What are the key properties of N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine?
N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine has a molecular weight of 196.30 g/mol, XLogP of 0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[1-(1-methyl-4,5-dihydroimidazol-2-yl)prop-1-en-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 102409585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).