C29H38O2Si — CID 102409633
(1S,7aS)-3-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 102409633) has the molecular formula C29H38O2Si and a molecular weight of 446.71 g/mol. Its IUPAC name is (1S,7aS)-3-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (1S,7aS)-3-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 102409633 |
| Molecular Formula | C29H38O2Si |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (1S,7aS)-3-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CC[C@@H]1C(=O)C([C@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C2CCCC[C@H]21 |
| InChI | InChI=1S/C29H38O2Si/c1-6-24-25-19-13-14-20-26(25)27(28(24)30)21(2)31-32(29(3,4)5,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-12,15-18,21,24-25H,6,13-14,19-20H2,1-5H3/t21-,24-,25-/m0/s1 |
| InChIKey | HGMLMSBDDFNZDZ-TUSQITKMSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|