C15H22O6 — CID 102409905
(2R)-2-hydroxy-2-[(2R,3S,6R,8R,9S)-3-methoxy-9-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-10-en-2-yl]acetaldehyde (PubChem CID 102409905) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[(2R,3S,6R,8R,9S)-3-methoxy-9-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-10-en-2-yl]acetaldehyde.
| Compound Name | (2R)-2-hydroxy-2-[(2R,3S,6R,8R,9S)-3-methoxy-9-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-10-en-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 102409905 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R)-2-hydroxy-2-[(2R,3S,6R,8R,9S)-3-methoxy-9-methyl-8-(2-oxoethyl)-1,7-dioxaspiro[5.5]undec-10-en-2-yl]acetaldehyde |
| SMILES | CO[C@H]1CC[C@]2(C=C[C@H](C)[C@@H](CC=O)O2)O[C@@H]1[C@@H](O)C=O |
| InChI | InChI=1S/C15H22O6/c1-10-3-6-15(20-12(10)5-8-16)7-4-13(19-2)14(21-15)11(18)9-17/h3,6,8-14,18H,4-5,7H2,1-2H3/t10-,11-,12+,13-,14+,15-/m0/s1 |
| InChIKey | JOXRJLBDWSAEDJ-UJOWSUJOSA-N |
| XLogP | 0.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|