About fluoren-9-one
fluoren-9-one (PubChem CID 10241) has the molecular formula C13H8O
and a molecular weight of 180.21 g/mol. Its IUPAC name is fluoren-9-one.
Molecular Properties
| Compound Name | fluoren-9-one |
| PubChem CID | 10241 |
| Molecular Formula | C13H8O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H8O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H |
| InChIKey | YLQWCDOCJODRMT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoren-9-one?
The IUPAC name of fluoren-9-one (CID 10241) is fluoren-9-one.
What is the SMILES notation for fluoren-9-one?
The canonical SMILES for fluoren-9-one is O=C1c2ccccc2-c2ccccc21.
What is the InChIKey of fluoren-9-one?
The InChIKey is YLQWCDOCJODRMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H.
What are the key properties of fluoren-9-one?
fluoren-9-one has a molecular weight of 180.21 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoren-9-one is sourced from PubChem (CID 10241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).