About 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene
1-methoxy-7-methyl-3,4-dihydro-1H-isochromene (PubChem CID 102410115) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene |
| PubChem CID | 102410115 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene |
| SMILES | COC1OCCc2ccc(C)cc21 |
| InChI | InChI=1S/C11H14O2/c1-8-3-4-9-5-6-13-11(12-2)10(9)7-8/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | SNQLLQIJDMTIRS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene?
The IUPAC name of 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene (CID 102410115) is 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene?
The canonical SMILES for 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene is COC1OCCc2ccc(C)cc21.
What is the InChIKey of 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene?
The InChIKey is SNQLLQIJDMTIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-8-3-4-9-5-6-13-11(12-2)10(9)7-8/h3-4,7,11H,5-6H2,1-2H3.
What are the key properties of 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene?
1-methoxy-7-methyl-3,4-dihydro-1H-isochromene has a molecular weight of 178.23 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-7-methyl-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 102410115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).