C26H38N4O8S — CID 102410439
N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-5-formyl-2-hydroxybenzamide (PubChem CID 102410439) has the molecular formula C26H38N4O8S and a molecular weight of 566.68 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-5-formyl-2-hydroxybenzamide.
| Compound Name | N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-5-formyl-2-hydroxybenzamide |
|---|---|
| PubChem CID | 102410439 |
| Molecular Formula | C26H38N4O8S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-5-formyl-2-hydroxybenzamide |
| SMILES | O=Cc1ccc(O)c(C(=O)NCCOCCOCCOCCNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)c1 |
| InChI | InChI=1S/C26H38N4O8S/c31-16-18-5-6-21(32)19(15-18)25(34)28-8-10-37-12-14-38-13-11-36-9-7-27-23(33)4-2-1-3-22-24-20(17-39-22)29-26(35)30-24/h5-6,15-16,20,22,24,32H,1-4,7-14,17H2,(H,27,33)(H,28,34)(H2,29,30,35)/t20-,22-,24-/m0/s1 |
| InChIKey | QVZKXTSEUWRWLX-SSPYTLHUSA-N |
| XLogP | 0.83 |
| TPSA | 164.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|