methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate

C7H11NO3 — CID 10241055

IUPACmethyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate
SMILESCOC(=O)[C@H]1NC(=O)C[C@@H]1C
InChIInChI=1S/C7H11NO3/c1-4-3-5(9)8-6(4)7(10)11-2/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m0/s1
InChIKeyVUGCWZURFXUZJX-NJGYIYPDSA-N
MW157.17 g/mol
LogP-0.32
Rot. Bonds1

About methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate

methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 10241055) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate
PubChem CID10241055
Molecular FormulaC7H11NO3
Molecular Weight157.17 g/mol
Exact Mass157.07
IUPAC Namemethyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate
SMILESCOC(=O)[C@H]1NC(=O)C[C@@H]1C
InChIInChI=1S/C7H11NO3/c1-4-3-5(9)8-6(4)7(10)11-2/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m0/s1
InChIKeyVUGCWZURFXUZJX-NJGYIYPDSA-N
XLogP-0.32
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.17
LogP ≤ 5-0.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate?
The IUPAC name of methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate (CID 10241055) is methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate is COC(=O)[C@H]1NC(=O)C[C@@H]1C.
What is the InChIKey of methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate?
The InChIKey is VUGCWZURFXUZJX-NJGYIYPDSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-3-5(9)8-6(4)7(10)11-2/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m0/s1.
What are the key properties of methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate?
methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate has a molecular weight of 157.17 g/mol, XLogP of -0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S)-3-methyl-5-oxopyrrolidine-2-carboxylate is sourced from PubChem (CID 10241055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).